cas: 606931-01-5 — see every product listed under this CAS number, including other names
tert-butyl 4-(2-hydroxyethyl)-1,4-diazepane-1-carboxylate (CAS 606931-01-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F496410-250MG |
| cas | 606931-01-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 3173.90 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl 4-(2-hydroxyethyl)-1,4-diazepane-1-carboxylate (CAS 606931-01-5) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl 4-(2-hydroxyethyl)-1,4-diazepane-1-carboxylate. InChIKey: AOVWADYIVQEBHV-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl 4-(2-hydroxyethyl)-1,4-diazepane-1-carboxylate |
| InChIKey | AOVWADYIVQEBHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CC1)CCO |
Computed by PubChem (NCBI)