cas: 20768-14-3 — see every product listed under this CAS number, including other names
tert-butyl 4-nitrophenoxyacetate, 97%, 97% (CAS 20768-14-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1380VJ-1g |
| cas | 20768-14-3 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1139.60 Pln | |
| Chemat | 5g | 4437.20 Pln | |
| Chemat | 25g | 19038.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-(4-nitrophenoxy)acetate (CAS 20768-14-3) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: tert-butyl 2-(4-nitrophenoxy)acetate. InChIKey: ASMSZGIOBJIOLQ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | tert-butyl 2-(4-nitrophenoxy)acetate |
| InChIKey | ASMSZGIOBJIOLQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)