cas: 138027-02-8 — see every product listed under this CAS number, including other names
tert-butyl cis-octahydropyrrolo[3,4-b]morpholine-6-carboxylate, 97% (CAS 138027-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519899-100MG |
| cas | 138027-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 435.28 Pln | |
| Fluorochem | 250mg | 872.63 Pln | |
| Fluorochem | 500mg | 1684.84 Pln | |
| Fluorochem | 1g | 2877.13 Pln | |
| Fluorochem | 5g | 10780.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate (CAS 138027-02-8) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: AUXXIKSVHUSTOA-DTWKUNHWSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | AUXXIKSVHUSTOA-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H](C1)OCCN2 |
Computed by PubChem (NCBI)