cas: 1461-97-8 — see every product listed under this CAS number, including other names
trans-1,2-Cyclopentanedicarboxylic acid, 97%, 97% (CAS 1461-97-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DPK-250mg |
| cas | 1461-97-8 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 626.00 Pln | |
| Chemat | 15g | 880.40 Pln | |
| Chemat | 25g | 1211.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid (CAS 1461-97-8) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid. InChIKey: ASJCSAKCMTWGAH-RFZPGFLSSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1R,2R)-cyclopentane-1,2-dicarboxylic acid |
| InChIKey | ASJCSAKCMTWGAH-RFZPGFLSSA-N |
| SMILES | C1C[C@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)