cas: 1414958-09-0 — see every product listed under this CAS number, including other names
trans-1-(tert-Butoxycarbonyl)-3-methylpiperidine-4-carboxylic acid 98% (CAS 1414958-09-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986452-50mg |
| cas | 1414958-09-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 987.81 Pln | |
| Ambeed | 100mg | 1510.69 Pln | |
| Ambeed | 250mg | 1799.94 Pln | |
| Ambeed | 1g | 4392.06 Pln | |
| Ambeed | 5g | 16846.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A986452 |
(3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1414958-09-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: ZFQQTPBWJCJGSV-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | ZFQQTPBWJCJGSV-IUCAKERBSA-N |
| SMILES | C[C@H]1CN(CC[C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)