cas: 1414958-09-0 — see every product listed under this CAS number, including other names
trans-1-N-Boc-3-methylpiperidine-4-carboxylic acid, 98%, 98% (CAS 1414958-09-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GHB-50mg |
| cas | 1414958-09-0 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 674.00 Pln | |
| Chemat | 100mg | 798.80 Pln | |
| Chemat | 250mg | 1538.00 Pln | |
| Chemat | 1g | 4470.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1414958-09-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: ZFQQTPBWJCJGSV-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R,4S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | ZFQQTPBWJCJGSV-IUCAKERBSA-N |
| SMILES | C[C@H]1CN(CC[C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)