cas: 80896-73-7 — see every product listed under this CAS number, including other names
trans-1-Benzyl-4-phenylpyrrolidine-3-carboxylic acid, 98%, 98% (CAS 80896-73-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149F9-100mg |
| cas | 80896-73-7 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1350.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid (CAS 80896-73-7) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid. InChIKey: IMROELKPEBZHGE-DLBZAZTESA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | IMROELKPEBZHGE-DLBZAZTESA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)