cas: 80896-73-7 — see every product listed under this CAS number, including other names
trans-1-Benzyl-4-phenylpyrrolidine-3-carboxylic acid, 98+% (CAS 80896-73-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A627083-5g |
| cas | 80896-73-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6202.42 Pln | |
| AmBeed | 1g | 5141.29 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid (CAS 80896-73-7) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid. InChIKey: IMROELKPEBZHGE-DLBZAZTESA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | IMROELKPEBZHGE-DLBZAZTESA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)