cas: 80896-73-7 — see every product listed under this CAS number, including other names
TRANS-1-BENZYL-4-PHENYLPYRROLIDINE-3-CARBOXYLIC ACID, 98% (CAS 80896-73-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502037-1G |
| cas | 80896-73-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1721.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid (CAS 80896-73-7) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid. InChIKey: IMROELKPEBZHGE-DLBZAZTESA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | IMROELKPEBZHGE-DLBZAZTESA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)