CAS 55116-03-5 is the registry number for trans-2,6-Dimethylpiperazine dihydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2R,6R)-2,6-dimethylpiperazine;dihydrochloride (CAS 55116-03-5) is a chemical compound with the molecular formula C6H16Cl2N2 and a molecular weight of 187.11 g/mol. IUPAC name: (2R,6R)-2,6-dimethylpiperazine;dihydrochloride. InChIKey: SFOYHYMXNYOPAI-BNTLRKBRSA-N.
| Molecular formula | C6H16Cl2N2 |
|---|---|
| Molecular weight | 187.11 g/mol |
| IUPAC name | (2R,6R)-2,6-dimethylpiperazine;dihydrochloride |
| InChIKey | SFOYHYMXNYOPAI-BNTLRKBRSA-N |
| SMILES | C[C@@H]1CNC[C@H](N1)C.Cl.Cl |
Computed by PubChem (NCBI)