trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid 95%
cas: 31420-60-7 — see every product listed under this CAS number, including other names
trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid 95% (CAS 31420-60-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A877567-100mg |
| cas | 31420-60-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1054.56 Pln | |
| Ambeed | 5g | 3012.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A877567 |
Trans-(1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid (CAS 31420-60-7) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: trans-(1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid. InChIKey: DLSMGFKPSMYVFW-RFZPGFLSSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | trans-(1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid |
| InChIKey | DLSMGFKPSMYVFW-RFZPGFLSSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
rac-(1r,2r)-2-(methoxycarbonyl)cyclobutane-1-carboxylic acid, trans-2-(Methoxycarbonyl)cyclobutane-1-carboxylic acid, trans-2-(methoxycarbonyl)cyclobutanecarboxylic acid, (1R,2R)-2-(Methoxycarbonyl)cyclobutane-1-carboxylic acid, (1R,2R)-2-methoxycarbonylcyclobutanecarboxylic acid, (1R,2R)-2-methoxycarbonylcyclobutane-1-carboxylic acid, (1R,2R)-2-(methoxycarbonyl)cyclobutane-1-carboxylic acid, trans, trans-2-(met, re1-1-Methyl (1R,2R)-1,2-cyclobutanedicar boxylate