cas: 369623-85-8 — see every product listed under this CAS number, including other names
trans-4-Amino-1-(tert-butoxycarbonyl)pyrrolidine-3-carboxylic acid, 95%, 95% (CAS 369623-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZQ9-100mg |
| cas | 369623-85-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1331.60 Pln | |
| Chemat | 5g | 4106.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S,4R)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 369623-85-8) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: (3S,4R)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: OSQJCAMJAGJCSX-BQBZGAKWSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (3S,4R)-4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | OSQJCAMJAGJCSX-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)N)C(=O)O |
Computed by PubChem (NCBI)