cas: 2006333-41-9 — see every product listed under this CAS number, including other names
trans-4-Fluoropyrrolidin-3-ol hydrochloride 98% (CAS 2006333-41-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A599117-1g |
| cas | 2006333-41-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 615.13 Pln | |
| Ambeed | 10g | 1015.62 Pln | |
| Ambeed | 25g | 1833.31 Pln | |
| Ambeed | 100g | 5721.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A599117 |
(3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 2006333-41-9) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-VKKIDBQXSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)