cas: 2006333-41-9 — see every product listed under this CAS number, including other names
trans-4-Fluoropyrrolidin-3-ol hydrochloride, 97%, 97% (CAS 2006333-41-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CVR-25g |
| cas | 2006333-41-9 |
| size | 25g |
| availability | 39g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 1235.60 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 10g | 568.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 2006333-41-9) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-VKKIDBQXSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3R,4R)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)