cas: 2503-31-3 — see every product listed under this CAS number, including other names
((Benzyloxy)carbonyl)alanylglycine, 95%, 95% (CAS 2503-31-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2HN-100mg |
| cas | 2503-31-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1509.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetic acid (CAS 2503-31-3) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: 2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetic acid. InChIKey: RNBMQRYMCAVZPN-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 2-[2-(phenylmethoxycarbonylamino)propanoylamino]acetic acid |
| InChIKey | RNBMQRYMCAVZPN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)