CAS 13139-52-1 appears in our catalog under these names: Z–D–Gln–OH, N2-Cbz-D-glutamine, Z-D-Gln-OH, Cbz-D-Gln-OH 98%, Cbz-D-Gln-OH 97%. Offered by: GLPBio, TRC, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 2,5g, 5g, 25g, 250mg, 100g, 100mg, 10g.
(2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 13139-52-1) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: (2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: JIMLDJNLXLMGLX-SNVBAGLBSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R)-5-amino-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | JIMLDJNLXLMGLX-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)