cas: 38235-77-7 — see every product listed under this CAS number, including other names
(+)-Benzylphenethylamine, 99.89% (CAS 38235-77-7) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 g, 50 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-41390-5 g |
| cas | 38235-77-7 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 263.96 Pln | |
| MedChemExpress | 100 g | 719.08 Pln | |
| MedChemExpress | 50 g | 575.11 Pln | |
| MedChemExpress | 10 g | 333.62 Pln | |
| MedChemExpress | 25 g | 477.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.89% |
(1R)-N-benzyl-1-phenylethanamine (CAS 38235-77-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (1R)-N-benzyl-1-phenylethanamine. InChIKey: ZYZHMSJNPCYUTB-CYBMUJFWSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (1R)-N-benzyl-1-phenylethanamine |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)