cas: 38235-77-7 — see every product listed under this CAS number, including other names
(+)-Benzylphenethylamine 96% (CAS 38235-77-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A252635-5g |
| cas | 38235-77-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 854.31 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A252635 |
(1R)-N-benzyl-1-phenylethanamine (CAS 38235-77-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (1R)-N-benzyl-1-phenylethanamine. InChIKey: ZYZHMSJNPCYUTB-CYBMUJFWSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (1R)-N-benzyl-1-phenylethanamine |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)