cas: 38235-77-7 — see every product listed under this CAS number, including other names
(R)-(+)-N-Benzyl-1-phenylethylamine, 97% (CAS 38235-77-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F012696-1G |
| cas | 38235-77-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 50g | 164.54 Pln | |
| Fluorochem | 100g | 237.43 Pln | |
| Fluorochem | 250g | 466.52 Pln | |
| Fluorochem | 500g | 752.88 Pln | |
| Fluorochem | 1kg | 1372.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(1R)-N-benzyl-1-phenylethanamine (CAS 38235-77-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (1R)-N-benzyl-1-phenylethanamine. InChIKey: ZYZHMSJNPCYUTB-CYBMUJFWSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (1R)-N-benzyl-1-phenylethanamine |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)