cas: 38235-77-7 — see every product listed under this CAS number, including other names
(R)-(+)-N-Benzyl-1-phenylethylamine, >98.0%(GC) (CAS 38235-77-7) is a chemical reagent available from Chemat. Available pack sizes: 5ml, 25ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1528-5ML |
| cas | 38235-77-7 |
| size | 5ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5ml | 167.52 Pln | |
| TCI | 25ml | 477.30 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
(1R)-N-benzyl-1-phenylethanamine (CAS 38235-77-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (1R)-N-benzyl-1-phenylethanamine. InChIKey: ZYZHMSJNPCYUTB-CYBMUJFWSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (1R)-N-benzyl-1-phenylethanamine |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)