(+)-Propranolol hydrochloride, ≥98%, ≥98%
cas: 13071-11-9 — see every product listed under this CAS number, including other names
(+)-Propranolol hydrochloride, ≥98%, ≥98% (CAS 13071-11-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HS9T-100mg |
| cas | 13071-11-9 |
| size | 100mg |
| availability | 2.5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 995.60 Pln | |
| Chemat | 500mg | 1576.40 Pln |
properties
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride (CAS 13071-11-9) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 295.80 g/mol. IUPAC name: (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride. InChIKey: ZMRUPTIKESYGQW-PFEQFJNWSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 295.80 g/mol |
| IUPAC name | (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| InChIKey | ZMRUPTIKESYGQW-PFEQFJNWSA-N |
| SMILES | CC(C)NC[C@H](COC1=CC=CC2=CC=CC=C21)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
Dexpropranolol hydrochloride, Dexpropranolol HCl, (+)-PROPRANOLOL HYDROCHLORIDE, Propranolol hydrochloride, (r)-, d-Propranolol hydrochloride, (+)-1-(Isopropylamino)-3-(1-naphthyloxy)-2-propanol hydrochloride, (2R)-3-(naphthalen-1-yloxy)-1-(propan-2-ylamino)propan-2-ol hydrochloride, (R)-(+)-Propranolol hydrochloride, Dexpropranolol hydrochloride [USAN], (R)-Propranolol hydrochloride