Products 1512718-16-9

CAS 1512718-16-9 is the registry number for (+/-)-(1,4-Dioxan-2-yl)methyl 4-methylbenzenesulfonate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,4-dioxan-2-ylmethyl 4-methylbenzenesulfonate (CAS 1512718-16-9) is a chemical compound with the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. IUPAC name: 1,4-dioxan-2-ylmethyl 4-methylbenzenesulfonate. InChIKey: JOMHMWCSNNGYNP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O5S
Molecular weight272.32 g/mol
IUPAC name1,4-dioxan-2-ylmethyl 4-methylbenzenesulfonate
InChIKeyJOMHMWCSNNGYNP-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCC2COCCO2

Computed by PubChem (NCBI)