Products 2113411-01-9
CAS 2113411-01-9 is the registry number for Ethyl 2-((3-hydroxyphenyl)sulfonyl)-2-methylpropanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3-hydroxyphenyl)sulfonyl-2-methylpropanoate (CAS 2113411-01-9) is a chemical compound with the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. IUPAC name: ethyl 2-(3-hydroxyphenyl)sulfonyl-2-methylpropanoate. InChIKey: IXUUUSYAPPAXJQ-UHFFFAOYSA-N.
| Molecular formula | C12H16O5S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | ethyl 2-(3-hydroxyphenyl)sulfonyl-2-methylpropanoate |
| InChIKey | IXUUUSYAPPAXJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)S(=O)(=O)C1=CC=CC(=C1)O |
Computed by PubChem (NCBI)