Products 917882-64-5
CAS 917882-64-5 appears in our catalog under these names: (S)-(1,4-Dioxan-2-yl)methyl 4-methylbenzenesulfonate, 95%, (1,4-dioxan-2-yl)methyl 4-methylbenzene-1-sulfonate, (S)-(1,4-Dioxan-2-yl)methyl 4-methylbenzenesulfonate 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg.
[(2S)-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate (CAS 917882-64-5) is a chemical compound with the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. IUPAC name: [(2S)-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: JOMHMWCSNNGYNP-NSHDSACASA-N.
| Molecular formula | C12H16O5S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | [(2S)-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | JOMHMWCSNNGYNP-NSHDSACASA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2COCCO2 |
Computed by PubChem (NCBI)