CAS 1275811-23-8 appears in our catalog under these names: Ethyl 2-hydroxy-2-(4-methanesulfonylphenyl)propanoate, 95%, Ethyl 2-hydroxy-2-(4-methanesulfonylphenyl)propanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
Ethyl 2-hydroxy-2-(4-methylsulfonylphenyl)propanoate (CAS 1275811-23-8) is a chemical compound with the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. IUPAC name: ethyl 2-hydroxy-2-(4-methylsulfonylphenyl)propanoate. InChIKey: AZJKMFZTYXNSBS-UHFFFAOYSA-N.
| Molecular formula | C12H16O5S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | ethyl 2-hydroxy-2-(4-methylsulfonylphenyl)propanoate |
| InChIKey | AZJKMFZTYXNSBS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C1=CC=C(C=C1)S(=O)(=O)C)O |
Computed by PubChem (NCBI)