CAS 1820569-65-0 is the registry number for (+/-)-Trans-4-(2-fluorophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(3R,4S)-4-(2-fluorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1820569-65-0) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: (3R,4S)-4-(2-fluorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: IWHIRKZZFPGHKK-RJUBDTSPSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | (3R,4S)-4-(2-fluorophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | IWHIRKZZFPGHKK-RJUBDTSPSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CC=C2F.Cl |
Computed by PubChem (NCBI)