cas: 328086-60-8 — see every product listed under this CAS number, including other names
(αS,3S)-α-[(tert-Butyloxycarbonyl)amino]-2-oxo-3-pyrrolidinepropanoic acid Methyl Ester, 97%, 97% (CAS 328086-60-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CA1L-250mg |
| cas | 328086-60-8 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 50g | 405.20 Pln | |
| Chemat | 100g | 650.00 Pln | |
| Chemat | 250g | 1533.20 Pln | |
| Chemat | 500g | 3076.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate (CAS 328086-60-8) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate. InChIKey: HTQMBOWAEPNWLI-IUCAKERBSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
| InChIKey | HTQMBOWAEPNWLI-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)OC |
Computed by PubChem (NCBI)