CAS 2768834-14-4 appears in our catalog under these names: Nirmatrelvir Impurity 33, methyl (2R)-2-(tert-butoxycarbonylamino)-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate (CAS 2768834-14-4) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate. InChIKey: HTQMBOWAEPNWLI-RKDXNWHRSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate |
| InChIKey | HTQMBOWAEPNWLI-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C[C@H]1CCNC1=O)C(=O)OC |
Computed by PubChem (NCBI)