CAS 2768833-99-2 appears in our catalog under these names: Methyl (S)-2-((tert-butoxycarbonyl)amino)-3-((R)-2-oxopyrrolidin-3-yl)propanoate, 95%, Nirmatrelvir Impurity 32. Offered by: AmBeed, Chemat Brand. Available pack sizes: 1g, 250mg, 5g, on request.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate (CAS 2768833-99-2) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate. InChIKey: HTQMBOWAEPNWLI-BDAKNGLRSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3R)-2-oxopyrrolidin-3-yl]propanoate |
| InChIKey | HTQMBOWAEPNWLI-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@H]1CCNC1=O)C(=O)OC |
Computed by PubChem (NCBI)