CAS 36301-70-9 is the registry number for 1-Boc-l-prolyl-l-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]propanoic acid (CAS 36301-70-9) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: CYRRXYLLNDVBCL-IUCAKERBSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | CYRRXYLLNDVBCL-IUCAKERBSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)