CAS 2768834-00-8 appears in our catalog under these names: Nirmatrelvir Impurity 34, Methyl (R)-2-((tert-butoxycarbonyl)amino)-3-((S)-2-oxopyrrolidin-3-yl)propanoate, 95%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g, 250mg, 1g.
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate (CAS 2768834-00-8) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate. InChIKey: HTQMBOWAEPNWLI-DTWKUNHWSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanoate |
| InChIKey | HTQMBOWAEPNWLI-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C[C@@H]1CCNC1=O)C(=O)OC |
Computed by PubChem (NCBI)