(-)-Coclaurine hydrochloride
cas: 3422-42-2 — see every product listed under this CAS number, including other names
(-)-Coclaurine hydrochloride (CAS 3422-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | TN1519L-1mg |
| cas | 3422-42-2 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 1428.68 Pln | |
| TargetMol | 5mg | 2955.87 Pln | |
| TargetMol | 10mg | 4270.64 Pln | |
| TargetMol | 25mg | 6422.79 Pln | |
| TargetMol | 50mg | 8906.43 Pln | |
| TargetMol | 100mg | 11934.53 Pln | |
| TargetMol | 500mg | 23669.06 Pln | |
| Chemat | 1mg | 587.60 Pln | |
| Chemat | 5mg | 1259.60 Pln | |
| Chemat | 10mg | 1835.60 Pln | |
| Chemat | 25mg | 2891.60 Pln | |
| Chemat | 50mg | 3904.40 Pln | |
| Chemat | 100mg | 5219.60 Pln | |
| Chemat | 200mg | 6856.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
(1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol;hydrochloride (CAS 3422-42-2) is a chemical compound with the molecular formula C17H20ClNO3 and a molecular weight of 321.8 g/mol. IUPAC name: (1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol;hydrochloride. InChIKey: VDUZDGFETHGVJK-RSAXXLAASA-N.
| Molecular formula | C17H20ClNO3 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | (1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol;hydrochloride |
| InChIKey | VDUZDGFETHGVJK-RSAXXLAASA-N |
| SMILES | COC1=C(C=C2[C@@H](NCCC2=C1)CC3=CC=C(C=C3)O)O.Cl |
Computed by PubChem (NCBI)