CAS 1279028-21-5 appears in our catalog under these names: (R)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride, 97%, (R)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride, 97%, 97%, O-Benzyl-D-serine benzyl ester hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
Benzyl (2R)-2-amino-3-phenylmethoxypropanoate;hydrochloride (CAS 1279028-21-5) is a chemical compound with the molecular formula C17H20ClNO3 and a molecular weight of 321.8 g/mol. IUPAC name: benzyl (2R)-2-amino-3-phenylmethoxypropanoate;hydrochloride. InChIKey: BGAVLJMLSSCOSD-PKLMIRHRSA-N.
| Molecular formula | C17H20ClNO3 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | benzyl (2R)-2-amino-3-phenylmethoxypropanoate;hydrochloride |
| InChIKey | BGAVLJMLSSCOSD-PKLMIRHRSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H](C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)