Products 890416-03-2
CAS 890416-03-2 is the registry number for Aposcopolamine Hydrochloride Salt. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 2-phenylprop-2-enoate;hydrochloride (CAS 890416-03-2) is a chemical compound with the molecular formula C17H20ClNO3 and a molecular weight of 321.8 g/mol. IUPAC name: (9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 2-phenylprop-2-enoate;hydrochloride. InChIKey: QAVHVYYGPPOIEY-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO3 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | (9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl) 2-phenylprop-2-enoate;hydrochloride |
| InChIKey | QAVHVYYGPPOIEY-UHFFFAOYSA-N |
| SMILES | CN1C2CC(CC1C3C2O3)OC(=O)C(=C)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)