Products 1798004-35-9
CAS 1798004-35-9 is the registry number for rel-Desethylreboxetine Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
2-[(R)-[(2R)-morpholin-2-yl]-phenylmethoxy]phenol;hydrochloride (CAS 1798004-35-9) is a chemical compound with the molecular formula C17H20ClNO3 and a molecular weight of 321.8 g/mol. IUPAC name: 2-[(R)-[(2R)-morpholin-2-yl]-phenylmethoxy]phenol;hydrochloride. InChIKey: OXMHTYUDUNJEHC-GBNZRNLASA-N.
| Molecular formula | C17H20ClNO3 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 2-[(R)-[(2R)-morpholin-2-yl]-phenylmethoxy]phenol;hydrochloride |
| InChIKey | OXMHTYUDUNJEHC-GBNZRNLASA-N |
| SMILES | C1CO[C@H](CN1)[C@@H](C2=CC=CC=C2)OC3=CC=CC=C3O.Cl |
Computed by PubChem (NCBI)