Products 3422-42-2
CAS 3422-42-2 appears in our catalog under these names: (-)-Coclaurine Hydrochloride, >95% (HPLC), (-)-Coclaurine hydrochloride, (-)-Coclaurine (hydrochloride), 98.20%. Offered by: TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol;hydrochloride (CAS 3422-42-2) is a chemical compound with the molecular formula C17H20ClNO3 and a molecular weight of 321.8 g/mol. IUPAC name: (1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol;hydrochloride. InChIKey: VDUZDGFETHGVJK-RSAXXLAASA-N.
| Molecular formula | C17H20ClNO3 |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | (1S)-1-[(4-hydroxyphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol;hydrochloride |
| InChIKey | VDUZDGFETHGVJK-RSAXXLAASA-N |
| SMILES | COC1=C(C=C2[C@@H](NCCC2=C1)CC3=CC=C(C=C3)O)O.Cl |
Computed by PubChem (NCBI)