cas: 1135-66-6 — see every product listed under this CAS number, including other names
(-)-Isolongifolene (CAS 1135-66-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCQ4-1mg |
| cas | 1135-66-6 |
| size | 1mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 347.60 Pln | |
| Chemat | 2mg | 491.60 Pln | |
| Chemat | 5mg | 803.60 Pln | |
| Chemat | 100mg | 870.80 Pln |
| delivery time | 3 weeks |
|---|
(1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene (CAS 1135-66-6) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene. InChIKey: CQUAYTJDLQBXCQ-NHYWBVRUSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene |
| InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
| SMILES | CC1(CCC=C2[C@@]13CC[C@@H](C3)C2(C)C)C |
Computed by PubChem (NCBI)