cas: 1135-66-6 — see every product listed under this CAS number, including other names
Isolongifolene, 98.0% (CAS 1135-66-6) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 10 mg, 5 mg, 10mM/1mL, 100 mg, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N7363-50 mg |
| cas | 1135-66-6 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 2400.20 Pln | |
| MedChemExpress | 10 mg | 1030.22 Pln | |
| MedChemExpress | 5 mg | 695.86 Pln | |
| MedChemExpress | 10mM/1mL | 751.58 Pln | |
| MedChemExpress | 100 mg | 3477.61 Pln | |
| MedChemExpress | 25 mg | 1657.16 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene (CAS 1135-66-6) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene. InChIKey: CQUAYTJDLQBXCQ-NHYWBVRUSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene |
| InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
| SMILES | CC1(CCC=C2[C@@]13CC[C@@H](C3)C2(C)C)C |
Computed by PubChem (NCBI)