CAS 1135-66-6 appears in our catalog under these names: Isolongifolene, 95%, Isolongifolene/ 99.31% (existing batch purity), Isolongifolene, (-)-ISOLONGIFOLENE, >=98.0% GC SUM OF&, (-)-Isolongifolene. Offered by: Combi-blocks, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 1ML, 2mg.
(1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene (CAS 1135-66-6) is a chemical compound with the molecular formula C15H24 and a molecular weight of 204.35 g/mol. IUPAC name: (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene. InChIKey: CQUAYTJDLQBXCQ-NHYWBVRUSA-N.
| Molecular formula | C15H24 |
|---|---|
| Molecular weight | 204.35 g/mol |
| IUPAC name | (1R,8S)-2,2,7,7-tetramethyltricyclo[6.2.1.01,6]undec-5-ene |
| InChIKey | CQUAYTJDLQBXCQ-NHYWBVRUSA-N |
| SMILES | CC1(CCC=C2[C@@]13CC[C@@H](C3)C2(C)C)C |
Computed by PubChem (NCBI)