CAS 77341-67-4 appears in our catalog under these names: 4-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)-4-oxobutanoic acid, 4-{[(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl]oxy}-4-oxobutyric acid, 95%,RG, (-)-Menthyl Succinate, >98.0%(GC)(T). Offered by: Chemat, Fluorochem, TCI. Available pack sizes: 5g, 25g, 1g.
4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid (CAS 77341-67-4) is a chemical compound with the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. IUPAC name: 4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid. InChIKey: BLILOGGUTRWFNI-GRYCIOLGSA-N.
| Molecular formula | C14H24O4 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 4-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-oxobutanoic acid |
| InChIKey | BLILOGGUTRWFNI-GRYCIOLGSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CCC(=O)O)C(C)C |
Computed by PubChem (NCBI)