CAS 204637-77-4 appears in our catalog under these names: (R)-4-(tert-Butoxy)-2-(cyclopentylmethyl)-4-oxobutanoic acid, 97%, (R)-4-(tert-Butoxy)-2-(cyclopentylmethyl)-4-oxobutanoic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-(cyclopentylmethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 204637-77-4) is a chemical compound with the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. IUPAC name: (2R)-2-(cyclopentylmethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: XJAASFPIJJMEQF-LLVKDONJSA-N.
| Molecular formula | C14H24O4 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | (2R)-2-(cyclopentylmethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | XJAASFPIJJMEQF-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](CC1CCCC1)C(=O)O |
Computed by PubChem (NCBI)