Products 2723436-81-3

CAS 2723436-81-3 is the registry number for 3-Cyclohexyl-2-(ethoxycarbonyl)-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-cyclohexyl-2-ethoxycarbonyl-3-methylbutanoic acid (CAS 2723436-81-3) is a chemical compound with the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. IUPAC name: 3-cyclohexyl-2-ethoxycarbonyl-3-methylbutanoic acid. InChIKey: PFRIMPVQJWOXDL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24O4
Molecular weight256.34 g/mol
IUPAC name3-cyclohexyl-2-ethoxycarbonyl-3-methylbutanoic acid
InChIKeyPFRIMPVQJWOXDL-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)O)C(C)(C)C1CCCCC1

Computed by PubChem (NCBI)