Products 59726-40-8

CAS 59726-40-8 is the registry number for Butalbital Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 2-(2-methylpropyl)-2-prop-2-enylpropanedioate (CAS 59726-40-8) is a chemical compound with the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. IUPAC name: diethyl 2-(2-methylpropyl)-2-prop-2-enylpropanedioate. InChIKey: QCQKKJOWCKVCLE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24O4
Molecular weight256.34 g/mol
IUPAC namediethyl 2-(2-methylpropyl)-2-prop-2-enylpropanedioate
InChIKeyQCQKKJOWCKVCLE-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC=C)(CC(C)C)C(=O)OCC

Computed by PubChem (NCBI)