cas: 1072806-65-5 — see every product listed under this CAS number, including other names
(1,3-benzoxazol-2-ylmethyl)amine hydrochloride (CAS 1072806-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F360898-100MG |
| cas | 1072806-65-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 2137.81 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-benzoxazol-2-ylmethanamine;hydrochloride (CAS 1072806-65-5) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 1,3-benzoxazol-2-ylmethanamine;hydrochloride. InChIKey: YYOVGEAEEZWWBC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1,3-benzoxazol-2-ylmethanamine;hydrochloride |
| InChIKey | YYOVGEAEEZWWBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CN.Cl |
Computed by PubChem (NCBI)