cas: 1072806-65-5 — see every product listed under this CAS number, including other names
Benzo[d]oxazol-2-ylmethanamine hydrochloride 97% (CAS 1072806-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A533107-100mg |
| cas | 1072806-65-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 1282.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A533107 |
1,3-benzoxazol-2-ylmethanamine;hydrochloride (CAS 1072806-65-5) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 1,3-benzoxazol-2-ylmethanamine;hydrochloride. InChIKey: YYOVGEAEEZWWBC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1,3-benzoxazol-2-ylmethanamine;hydrochloride |
| InChIKey | YYOVGEAEEZWWBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CN.Cl |
Computed by PubChem (NCBI)