cas: 1072806-65-5 — see every product listed under this CAS number, including other names
Benzo[d]oxazol-2-ylmethanamine hydrochloride, 97%, 97% (CAS 1072806-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119U5V-100mg |
| cas | 1072806-65-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 1307.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,3-benzoxazol-2-ylmethanamine;hydrochloride (CAS 1072806-65-5) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 1,3-benzoxazol-2-ylmethanamine;hydrochloride. InChIKey: YYOVGEAEEZWWBC-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 1,3-benzoxazol-2-ylmethanamine;hydrochloride |
| InChIKey | YYOVGEAEEZWWBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CN.Cl |
Computed by PubChem (NCBI)