cas: 1072945-92-6 — see every product listed under this CAS number, including other names
(1-(P-tolyl)-1H-pyrazol-4-yl)boronic acid, 98% (CAS 1072945-92-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218548-5G |
| cas | 1072945-92-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 3840.33 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[1-(4-methylphenyl)pyrazol-4-yl]boronic acid (CAS 1072945-92-6) is a chemical compound with the molecular formula C10H11BN2O2 and a molecular weight of 202.02 g/mol. IUPAC name: [1-(4-methylphenyl)pyrazol-4-yl]boronic acid. InChIKey: KQNRHNWJXQJCRY-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O2 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | [1-(4-methylphenyl)pyrazol-4-yl]boronic acid |
| InChIKey | KQNRHNWJXQJCRY-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)