CAS 1404466-88-1 appears in our catalog under these names: (3-(1-Methyl-1H-imidazol-2-yl)phenyl)boronic acid, 95+%, 3–(1–METHYL–1H–IMIDAZOL–2–YL)–PHENYL BORONIC ACID, (3-(1-Methyl-1H-imidazol-2-yl)phenyl)boronic acid, 99%, 99%, 3-(1-METHYL-1H-IMIDAZOL-2-YL)-PHENYL BORONIC ACID, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
[3-(1-methylimidazol-2-yl)phenyl]boronic acid (CAS 1404466-88-1) is a chemical compound with the molecular formula C10H11BN2O2 and a molecular weight of 202.02 g/mol. IUPAC name: [3-(1-methylimidazol-2-yl)phenyl]boronic acid. InChIKey: CQYYHRWADVKUOB-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O2 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | [3-(1-methylimidazol-2-yl)phenyl]boronic acid |
| InChIKey | CQYYHRWADVKUOB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NC=CN2C)(O)O |
Computed by PubChem (NCBI)