CAS 1228183-01-4 appears in our catalog under these names: 4–((1–Imidazolyl)methyl)phenylboronic Acid, 4-(imidazol-1-ylmethyl)phenylboronic acid, 95%, (4-(1H-Imidazol-1-ylmethyl)phenyl)boranediol. Offered by: GLPBio, Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
[4-(imidazol-1-ylmethyl)phenyl]boronic acid (CAS 1228183-01-4) is a chemical compound with the molecular formula C10H11BN2O2 and a molecular weight of 202.02 g/mol. IUPAC name: [4-(imidazol-1-ylmethyl)phenyl]boronic acid. InChIKey: WOPRITIOYMANHW-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O2 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | [4-(imidazol-1-ylmethyl)phenyl]boronic acid |
| InChIKey | WOPRITIOYMANHW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN2C=CN=C2)(O)O |
Computed by PubChem (NCBI)