CAS 852362-22-2 appears in our catalog under these names: 1H–Pyrazole–1–benzyl–4–boronic acid (contains varying amounts of Anhydride), (1-Benzyl-1H-pyrazol-4-yl)boronic acid 98%, (1-Benzyl-1H-pyrazol-4-yl)boronic acid, 98%, 98%, (1-Benzyl-1H-pyrazol-4-yl)boronic acid, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
1-Benzyl-1H-pyrazole-4-boronic acid is a member of benzenes.
Source: ChEBI
| Molecular formula | C10H11BN2O2 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | (1-benzylpyrazol-4-yl)boronic acid |
| InChIKey | JXNAIAOHYPDQQC-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)CC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)